CAS 1306604-54-5

Benzoic acid, 3-chloro-4-(4-pyridinyloxy)-, hydrochloride (1:1)

Description:

Benzoic acid, 3-chloro-4-(4-pyridinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its benzoic acid structure modified with a chloro group and a pyridinyloxy moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water, reflecting its hydrochloride form. The presence of the chloro substituent and the pyridinyloxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. The hydrochloride salt form enhances its stability and solubility, which is advantageous for various applications, including drug formulation. Its molecular structure suggests it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in medicinal chemistry and related fields.

Formula: C₁₂H₈ClNO₃·ClH

InChI: InChI=1S/C12H8ClNO3.ClH/c13-10-7-8(12(15)16)1-2-11(10)17-9-3-5-14-6-4-9;/h1-7H,(H,15,16);1H

InChI key: InChIKey=GQLLOXBJXDLKRB-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(C(O)=O)C=C1)C=2C=CN=CC2.Cl

Synonyms:

• Benzoic acid, 3-chloro-4-(4-pyridinyloxy)-, hydrochloride (1:1)

3-Chloro-4-(pyridin-4-yloxy)benzoic acid hydrochloride

CAS: 1306604-54-5

Versatile small molecule scaffold

Formula: C₁₂H₉Cl₂NO₃

Purity: Min. 95%

Molecular weight: 286.11 g/mol

Ref: 3D-GCC60454