CAS 1306604-68-1

Cyclopropanamine, 2-(4-bromophenyl)-, hydrochloride (1:1)

Description:

Cyclopropanamine, 2-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and an amine functional group. The presence of a 4-bromophenyl substituent indicates that a bromine atom is attached to a phenyl ring at the para position relative to the amine group. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit biological activity due to its amine functionality, which can participate in hydrogen bonding and interact with various biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as melting point, solubility, and reactivity, would be influenced by the presence of the bromine substituent and the hydrochloride form. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₀BrN·ClH

InChI: InChI=1S/C9H10BrN.ClH/c10-7-3-1-6(2-4-7)8-5-9(8)11;/h1-4,8-9H,5,11H2;1H

InChI key: InChIKey=XQXNVLZRIWWINX-UHFFFAOYSA-N

SMILES: NC1C(C1)C2=CC=C(Br)C=C2.Cl

Synonyms:

• Cyclopropanamine, 2-(4-bromophenyl)-, hydrochloride (1:1)

Cyclopropanamine, 2-​(4-​bromophenyl)​-​, hydrochloride (1:1)

CAS: 1306604-68-1

Formula: C₉H₁₁BrClN

Purity: 90%

Color and Shape: Solid

Molecular weight: 248.5473

Ref: IN-DA009K1Z

2-(4-Bromophenyl)cyclopropanamine hydrochloride

CAS: 1306604-68-1

2-(4-Bromophenyl)cyclopropanamine hydrochloride

Purity: 90%

Molecular weight: 248.55g/mol

Ref: 54-OR83437

2-(4-BROMOPHENYL)CYCLOPROPANAMINE HCL

CAS: 1306604-68-1

Formula: C₉H₁₁BrClN

Purity: 90%

Molecular weight: 248.55

Ref: 10-F530417