CAS 1306604-69-2

3-Furanmethanamine, 2,5-dimethyl-, hydrochloride (1:1)

Description:

3-Furanmethanamine, 2,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which contributes to its aromatic properties. The presence of the amine functional group indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The hydrochloride form suggests that it is a salt, enhancing its stability and solubility in aqueous solutions. This compound may exhibit biological activity due to its amine and furan functionalities, which are often found in various pharmaceuticals and agrochemicals. Its molecular structure implies that it could be involved in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the presence of methyl groups on the furan ring may influence its reactivity and steric properties. Overall, 3-Furanmethanamine, 2,5-dimethyl-, hydrochloride is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its potential applications and effects.

Formula: C₇H₁₁NO·ClH

InChI: InChI=1S/C7H11NO.ClH/c1-5-3-7(4-8)6(2)9-5;/h3H,4,8H2,1-2H3;1H

InChI key: InChIKey=GIWAAZTWCWKTQB-UHFFFAOYSA-N

SMILES: C(N)C1=C(C)OC(C)=C1.Cl

Synonyms:

• 3-Furanmethanamine, 2,5-dimethyl-, hydrochloride (1:1)
• (2,5-Dimethylfuran-3-yl)methanamine hydrochloride

(2,5-Dimethylfuran-3-yl)methanamine hydrochloride

CAS: 1306604-69-2

Versatile small molecule scaffold

Formula: C₇H₁₂ClNO

Purity: Min. 95%

Molecular weight: 161.63 g/mol

Ref: 3D-GCC60469