
CAS 1306604-73-8
:7-Bromo-4-oxo-3(4H)-quinazolineacetic acid
Description:
7-Bromo-4-oxo-3(4H)-quinazolineacetic acid is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. The presence of a bromine atom at the 7-position contributes to its reactivity and potential biological activity. The 4-oxo group indicates a carbonyl functional group, which can participate in various chemical reactions, while the acetic acid moiety suggests the presence of a carboxylic acid functional group, imparting acidic properties. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the bromine atom and the functional groups attached to the quinazoline framework. Overall, 7-Bromo-4-oxo-3(4H)-quinazolineacetic acid represents a unique structure with potential implications in various chemical and biological contexts.
Formula:C10H7BrN2O3
InChI:InChI=1S/C10H7BrN2O3/c11-6-1-2-7-8(3-6)12-5-13(10(7)16)4-9(14)15/h1-3,5H,4H2,(H,14,15)
InChI key:InChIKey=FKZDTNSWPDOOQJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(Br)=CC2)N=CN1CC(O)=O
Synonyms:- 3(4H)-Quinazolineacetic acid, 7-bromo-4-oxo-
- 7-Bromo-4-oxo-3(4H)-quinazolineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.