CAS 1306604-77-2

2-Chloro-N-[[4-(methoxymethyl)phenyl]methyl]acetamide

Description:

2-Chloro-N-[[4-(methoxymethyl)phenyl]methyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro group, which contributes to its reactivity, and an acetamide moiety that indicates potential interactions typical of amides, such as hydrogen bonding. The presence of a methoxymethyl group attached to a phenyl ring suggests that the compound may exhibit unique electronic properties and steric effects, influencing its solubility and reactivity. This compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as an intermediate in organic synthesis. Its molecular structure may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the chlorine atom may enhance its lipophilicity, affecting its bioavailability and pharmacokinetics. Safety and handling precautions should be observed due to the presence of the chloro group, which can pose health risks. Overall, 2-Chloro-N-[[4-(methoxymethyl)phenyl]methyl]acetamide is a compound with distinct chemical properties that warrant further investigation for potential applications.

Formula: C₁₁H₁₄ClNO₂

InChI: InChI=1S/C11H14ClNO2/c1-15-8-10-4-2-9(3-5-10)7-13-11(14)6-12/h2-5H,6-8H2,1H3,(H,13,14)

InChI key: InChIKey=AAMYOXZAXAEHNO-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)C1=CC=C(COC)C=C1

Synonyms:

• 2-Chloro-N-[[4-(methoxymethyl)phenyl]methyl]acetamide
• Acetamide, 2-chloro-N-[[4-(methoxymethyl)phenyl]methyl]-

2-Chloro-N-{[4-(methoxymethyl)phenyl]methyl}acetamide

CAS: 1306604-77-2

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 227.69 g/mol

Ref: 3D-GCC60477