
CAS 1306605-26-4
:2-Chloro-5-(1-propyl-2-piperidinyl)pyridine
Description:
2-Chloro-5-(1-propyl-2-piperidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a chlorine atom and at the 5-position with a propyl-2-piperidinyl group. This structure contributes to its potential biological activity, particularly in the realm of medicinal chemistry. The presence of the piperidine moiety suggests possible interactions with neurotransmitter systems, making it of interest in pharmacological research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific formulation and purity. Its molecular properties, such as melting point, boiling point, and reactivity, would be influenced by the substituents on the pyridine ring. As with many halogenated compounds, it may also display unique chemical reactivity, particularly in nucleophilic substitution reactions. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks. Overall, 2-Chloro-5-(1-propyl-2-piperidinyl)pyridine represents a compound of interest for further study in various chemical and biological applications.
Formula:C13H19ClN2
InChI:InChI=1S/C13H19ClN2/c1-2-8-16-9-4-3-5-12(16)11-6-7-13(14)15-10-11/h6-7,10,12H,2-5,8-9H2,1H3
InChI key:InChIKey=OKINFUVQNJJUGV-UHFFFAOYSA-N
SMILES:C(CC)N1C(CCCC1)C=2C=CC(Cl)=NC2
Synonyms:- Pyridine, 2-chloro-5-(1-propyl-2-piperidinyl)-
- 2-Chloro-5-(1-propyl-2-piperidinyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.