
CAS 1306605-28-6
:1-Propyl-2,3′-bipiperidine
Description:
1-Propyl-2,3′-bipiperidine is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain. This compound features a propyl group attached to one of the nitrogen atoms in the piperidine ring, influencing its physical and chemical properties. Typically, bipiperidine derivatives exhibit properties such as moderate solubility in organic solvents and potential biological activity, making them of interest in medicinal chemistry. The presence of nitrogen atoms in the piperidine rings contributes to basicity and potential interactions with biological targets. Additionally, the compound may exhibit specific stereochemistry, which can affect its reactivity and interactions. While detailed information on its specific applications or biological effects may vary, compounds of this class are often explored for their potential in drug development and as intermediates in organic synthesis. Safety data and handling precautions should be consulted due to the potential for toxicity associated with nitrogen-containing heterocycles.
Formula:C13H26N2
InChI:InChI=1S/C13H26N2/c1-2-9-15-10-4-3-7-13(15)12-6-5-8-14-11-12/h12-14H,2-11H2,1H3
InChI key:InChIKey=VQBZYKSDBIFFKV-UHFFFAOYSA-N
SMILES:C(CC)N1C(CCCC1)C2CCCNC2
Synonyms:- 2,3′-Bipiperidine, 1-propyl-
- 1-Propyl-2,3′-bipiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.