CymitQuimica logo

CAS 1306605-30-0

:

5-Methoxy-6-(2,2,2-trifluoroethoxy)-1H-indazole-3-acetic acid

Description:
5-Methoxy-6-(2,2,2-trifluoroethoxy)-1H-indazole-3-acetic acid is a synthetic compound characterized by its indazole core, which is a five-membered heterocyclic structure containing nitrogen. This compound features a methoxy group and a trifluoroethoxy substituent, contributing to its unique chemical properties. The presence of the trifluoroethoxy group enhances lipophilicity and may influence the compound's biological activity, making it of interest in medicinal chemistry. The acetic acid moiety suggests potential acidic behavior, which could affect solubility and reactivity in various environments. This compound may exhibit specific interactions with biological targets, potentially leading to therapeutic applications. Its molecular structure indicates that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. As with many synthetic compounds, understanding its stability, reactivity, and pharmacokinetics is essential for evaluating its potential uses in research or pharmaceuticals.
Formula:C12H11F3N2O4
InChI:InChI=1S/C12H11F3N2O4/c1-20-9-2-6-7(16-17-8(6)4-11(18)19)3-10(9)21-5-12(13,14)15/h2-3H,4-5H2,1H3,(H,16,17)(H,18,19)
InChI key:InChIKey=DLEYUMKBMIDOML-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(=CC(OCC(F)(F)F)=C(OC)C2)NN1
Synonyms:
  • 5-Methoxy-6-(2,2,2-trifluoroethoxy)-1H-indazole-3-acetic acid
  • 1H-Indazole-3-acetic acid, 5-methoxy-6-(2,2,2-trifluoroethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.