CAS 1306605-41-3

Ethanamine, 2-[3-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Ethanamine, 2-[3-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1), identified by CAS number 1306605-41-3, is a chemical compound that features a phenoxy group substituted with a tert-butyl group, which contributes to its hydrophobic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the ethanamine moiety suggests potential biological activity, as amines are often involved in interactions with biological receptors. This compound may exhibit properties such as basicity due to the amine group, and it could participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the tert-butyl group can provide steric hindrance, potentially affecting the compound's interaction with enzymes or receptors. Overall, the characteristics of this substance make it of interest in medicinal chemistry and related fields, where its specific interactions and effects can be further explored.

Formula: C₁₂H₁₉NO·ClH

InChI: InChI=1S/C12H19NO.ClH/c1-12(2,3)10-5-4-6-11(9-10)14-8-7-13;/h4-6,9H,7-8,13H2,1-3H3;1H

InChI key: InChIKey=GCHMRKZMUZEBIG-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=CC(OCCN)=CC=C1.Cl

Synonyms:

• Ethanamine, 2-[3-(1,1-dimethylethyl)phenoxy]-, hydrochloride (1:1)

1-(2-Aminoethoxy)-3-tert-butylbenzene hydrochloride

CAS: 1306605-41-3

Versatile small molecule scaffold

Formula: C₁₂H₂₀ClNO

Purity: Min. 95%

Molecular weight: 229.74 g/mol

Ref: 3D-GCC60541