
CAS 1306605-43-5
:β-(2-Phenylpropyl)-4-pyridineethanamine
Description:
β-(2-Phenylpropyl)-4-pyridineethanamine, identified by its CAS number 1306605-43-5, is a chemical compound that belongs to the class of amines. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with a phenylpropyl group. This structure suggests potential interactions with biological systems, particularly in the context of neurotransmitter modulation, as many pyridine derivatives are known for their pharmacological activities. The compound may exhibit characteristics such as solubility in organic solvents, and its behavior in aqueous environments can vary based on pH and the presence of other ions. Its molecular structure indicates potential for steric hindrance due to the bulky phenylpropyl group, which could influence its binding affinity to biological targets. Additionally, the presence of the amine functional group suggests that it may participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and pharmacology.
Formula:C16H20N2
InChI:InChI=1S/C16H20N2/c1-13(14-5-3-2-4-6-14)11-16(12-17)15-7-9-18-10-8-15/h2-10,13,16H,11-12,17H2,1H3
InChI key:InChIKey=TVVIEDYJMOQCNQ-UHFFFAOYSA-N
SMILES:C(CC(C)C1=CC=CC=C1)(CN)C=2C=CN=CC2
Synonyms:- 4-Pyridineethanamine, β-(2-phenylpropyl)-
- β-(2-Phenylpropyl)-4-pyridineethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.