CAS 1306605-65-1

4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanethioamide

Description:

4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanethioamide is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a bromine atom and a trifluoromethyl group. The presence of the thioamide functional group contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen and sulfur functionalities that can influence biological interactions. Additionally, the trifluoromethyl group is known to enhance lipophilicity, which can affect the compound's pharmacokinetic properties. Safety and handling precautions should be observed, as compounds containing bromine and sulfur can pose health risks. Overall, 4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanethioamide represents a class of compounds with significant potential for further research and application in various chemical and biological fields.

Formula: C₇H₇BrF₃N₃S

InChI: InChI=1S/C7H7BrF3N3S/c8-4-3-14(2-1-5(12)15)13-6(4)7(9,10)11/h3H,1-2H2,(H2,12,15)

InChI key: InChIKey=OBTWQVPVMWMMNU-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=NN(CCC(N)=S)C=C1Br

Synonyms:

• 1H-Pyrazole-1-propanethioamide, 4-bromo-3-(trifluoromethyl)-
• 4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-propanethioamide