CAS 1306605-69-5

2,2,2-Trifluoroethyl N-[2-chloro-5-[(dimethylamino)carbonyl]phenyl]carbamate

Description:

2,2,2-Trifluoroethyl N-[2-chloro-5-[(dimethylamino)carbonyl]phenyl]carbamate is a chemical compound characterized by its complex structure, which includes a trifluoroethyl group and a carbamate moiety. The presence of the trifluoroethyl group imparts unique properties, such as increased lipophilicity and potential bioactivity, making it of interest in pharmaceutical applications. The compound features a chloro-substituted phenyl ring, which can influence its reactivity and interaction with biological targets. Additionally, the dimethylamino group contributes to the compound's basicity and may enhance its solubility in various solvents. This compound is likely to exhibit specific pharmacological activities, potentially acting as an inhibitor or modulator in biological systems. Its synthesis and characterization would involve standard organic chemistry techniques, and safety precautions should be taken due to the presence of halogenated and nitrogen-containing functional groups, which may pose environmental and health risks. Overall, this compound represents a class of chemicals that may have applications in medicinal chemistry and agrochemicals.

Formula: C₁₂H₁₂ClF₃N₂O₃

InChI: InChI=1S/C12H12ClF3N2O3/c1-18(2)10(19)7-3-4-8(13)9(5-7)17-11(20)21-6-12(14,15)16/h3-5H,6H2,1-2H3,(H,17,20)

InChI key: InChIKey=HCNQIHYTGJUEDN-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC(C(N(C)C)=O)=CC=C1Cl

Synonyms:

• 2,2,2-Trifluoroethyl N-[2-chloro-5-[(dimethylamino)carbonyl]phenyl]carbamate
• Carbamic acid, N-[2-chloro-5-[(dimethylamino)carbonyl]phenyl]-, 2,2,2-trifluoroethyl ester

2,2,2-Trifluoroethyl N-[2-chloro-5-(dimethylcarbamoyl)phenyl]carbamate

CAS: 1306605-69-5

Versatile small molecule scaffold

Formula: C₁₂H₁₂ClF₃N₂O₃

Purity: Min. 95%

Molecular weight: 324.68 g/mol

Ref: 3D-GCC60569