CymitQuimica logo

CAS 1306605-93-5

:

β-(Phenylmethyl)-2-piperidineethanamine

Description:
β-(Phenylmethyl)-2-piperidineethanamine, also known as a specific type of substituted piperidine, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenylmethyl group, indicating the presence of a phenyl group attached to a methyl group, which is further connected to the piperidine backbone. The presence of the amine functional group contributes to its potential as a ligand in various chemical reactions and interactions. Typically, such compounds may exhibit biological activity, potentially influencing neurotransmitter systems due to their structural similarity to other biologically active amines. The compound's solubility, stability, and reactivity can vary based on its specific substituents and the environment in which it is placed. As with many piperidine derivatives, it may be of interest in medicinal chemistry for its potential therapeutic applications, although specific pharmacological properties would require further investigation. Always handle such compounds with care, adhering to safety protocols in a laboratory setting.
Formula:C14H22N2
InChI:InChI=1S/C14H22N2/c15-11-13(14-8-4-5-9-16-14)10-12-6-2-1-3-7-12/h1-3,6-7,13-14,16H,4-5,8-11,15H2
InChI key:InChIKey=CZRLDAXSBGABDL-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(CN)C2CCCCN2
Synonyms:
  • 2-Piperidineethanamine, β-(phenylmethyl)-
  • β-(Phenylmethyl)-2-piperidineethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.