
CAS 1306605-97-9
:β-(2,2-Dimethylpropyl)-2-pyridineethanamine
Description:
β-(2,2-Dimethylpropyl)-2-pyridineethanamine, identified by its CAS number 1306605-97-9, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by its aliphatic amine structure, where the amine group is attached to a carbon chain that includes a branched alkyl group (2,2-dimethylpropyl). The presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry and may influence its biological activity, making it of interest in medicinal chemistry. The branched alkyl group can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Additionally, the compound may exhibit basic properties due to the amine functional group, allowing it to participate in various chemical reactions, including protonation and nucleophilic attacks. Overall, the unique structural features of β-(2,2-Dimethylpropyl)-2-pyridineethanamine suggest it may have diverse applications in pharmaceuticals and organic synthesis.
Formula:C12H20N2
InChI:InChI=1S/C12H20N2/c1-12(2,3)8-10(9-13)11-6-4-5-7-14-11/h4-7,10H,8-9,13H2,1-3H3
InChI key:InChIKey=IVTINFPTBJPLOG-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(CN)C1=CC=CC=N1
Synonyms:- β-(2,2-Dimethylpropyl)-2-pyridineethanamine
- 2-Pyridineethanamine, β-(2,2-dimethylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.