CAS 1306606-04-1

5-Ethoxy-6-methoxy-1H-indazole-3-acetic acid

Description:

5-Ethoxy-6-methoxy-1H-indazole-3-acetic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features two substituents: an ethoxy group and a methoxy group, which contribute to its unique chemical properties and potential biological activity. The presence of the acetic acid moiety suggests that it may exhibit acidic behavior, influencing its solubility and reactivity in various environments. The compound's structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and pharmacology. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many indazole derivatives, it may possess interesting pharmacological properties, warranting further investigation for applications in drug development or therapeutic uses.

Formula: C₁₂H₁₄N₂O₄

InChI: InChI=1S/C12H14N2O4/c1-3-18-11-4-7-8(5-10(11)17-2)13-14-9(7)6-12(15)16/h4-5H,3,6H2,1-2H3,(H,13,14)(H,15,16)

InChI key: InChIKey=JCWAOBLXPCCSGM-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=2C(=CC(OC)=C(OCC)C2)NN1

Synonyms:

• 1H-Indazole-3-acetic acid, 5-ethoxy-6-methoxy-
• 5-Ethoxy-6-methoxy-1H-indazole-3-acetic acid