CAS 1306606-13-2

Octahydro-1H-indole-3-carboxamide

Description:

Octahydro-1H-indole-3-carboxamide, identified by its CAS number 1306606-13-2, is a cyclic amide compound characterized by its unique bicyclic structure. This substance features a saturated indole framework, which contributes to its potential biological activity. The presence of a carboxamide functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. Typically, compounds like this may exhibit properties such as moderate to high stability under standard conditions, and they may participate in hydrogen bonding due to the amide group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with various receptors or enzymes. Additionally, its synthesis often involves multi-step organic reactions, which can include cyclization and functional group transformations. Overall, Octahydro-1H-indole-3-carboxamide represents a class of compounds that are of interest for their potential therapeutic properties and their role in various chemical research applications.

Formula: C₉H₁₆N₂O

InChI: InChI=1S/C9H16N2O/c10-9(12)7-5-11-8-4-2-1-3-6(7)8/h6-8,11H,1-5H2,(H2,10,12)

InChI key: InChIKey=NXLRMAOYYSTDFK-UHFFFAOYSA-N

SMILES: C(N)(=O)C1C2C(NC1)CCCC2

Synonyms:

• Octahydro-1H-indole-3-carboxamide
• 1H-Indole-3-carboxamide, octahydro-