
CAS 1306606-32-5
:3-Amino-4-(2-furanylmethyl)-1H-pyrrole-2-carboxylic acid
Description:
3-Amino-4-(2-furanylmethyl)-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as an acid and a base, thus exhibiting amphoteric properties. The presence of the furanylmethyl group introduces additional reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its solubility in polar solvents is likely due to the presence of the carboxylic acid and amino groups, which can engage in hydrogen bonding. Additionally, the compound may exhibit specific optical properties due to the presence of the furan moiety, which can absorb light in certain wavelengths. Overall, this compound's unique structural features may render it useful in pharmaceutical applications or as a building block in organic synthesis.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c11-8-6(4-7-2-1-3-15-7)5-12-9(8)10(13)14/h1-3,5,12H,4,11H2,(H,13,14)
InChI key:InChIKey=AUUIVYYUQCJIHD-UHFFFAOYSA-N
SMILES:C(C=1C(N)=C(C(O)=O)NC1)C2=CC=CO2
Synonyms:- 3-Amino-4-(2-furanylmethyl)-1H-pyrrole-2-carboxylic acid
- 1H-Pyrrole-2-carboxylic acid, 3-amino-4-(2-furanylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.