
CAS 1306606-34-7
:2-(3-Chlorophenyl)-1H-benzimidazole-6-sulfonyl chloride
Description:
2-(3-Chlorophenyl)-1H-benzimidazole-6-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a benzimidazole core, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the 3-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly for the introduction of sulfonamide groups into various substrates. The compound is likely to be a solid at room temperature and may require careful handling due to the reactivity of the sulfonyl chloride moiety, which can release hydrochloric acid upon hydrolysis. Its applications may extend to pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when working with this compound due to its potential irritant properties.
Formula:C13H8Cl2N2O2S
InChI:InChI=1S/C13H8Cl2N2O2S/c14-9-3-1-2-8(6-9)13-16-11-5-4-10(20(15,18)19)7-12(11)17-13/h1-7H,(H,16,17)
InChI key:InChIKey=DTWREZGBPWFMMC-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C2C(N=C(N2)C3=CC(Cl)=CC=C3)=CC1
Synonyms:- 2-(3-Chlorophenyl)-1H-benzimidazole-6-sulfonyl chloride
- 1H-Benzimidazole-6-sulfonyl chloride, 2-(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.