
CAS 1306606-54-1
:6-Hydroxy-5-methoxy-2H-indazole-3-acetic acid
Description:
6-Hydroxy-5-methoxy-2H-indazole-3-acetic acid, with the CAS number 1306606-54-1, is a chemical compound that belongs to the indazole class of compounds. It features a fused indazole ring system, which is characterized by its nitrogen-containing heterocyclic structure. The presence of hydroxyl (-OH) and methoxy (-OCH3) functional groups contributes to its polar nature, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. The compound's stability, reactivity, and interaction with other molecules can be influenced by its functional groups and the overall electronic distribution within the indazole framework. As with many organic compounds, its properties such as melting point, boiling point, and solubility would need to be determined experimentally for specific applications. Overall, 6-Hydroxy-5-methoxy-2H-indazole-3-acetic acid represents a unique structure that may have implications in various fields of research.
Formula:C10H10N2O4
InChI:InChI=1S/C10H10N2O4/c1-16-9-2-5-6(3-8(9)13)11-12-7(5)4-10(14)15/h2-3,13H,4H2,1H3,(H,11,12)(H,14,15)
InChI key:InChIKey=HBHROXXTYUVZHA-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C2C(=NN1)C=C(O)C(OC)=C2
Synonyms:- 2H-Indazole-3-acetic acid, 6-hydroxy-5-methoxy-
- 6-Hydroxy-5-methoxy-2H-indazole-3-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.