CAS 1306606-58-5

5-Thiazolemethanamine, 2-(4-methoxyphenyl)-α,4-dimethyl-, hydrochloride (1:1)

Description:

5-Thiazolemethanamine, 2-(4-methoxyphenyl)-α,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. The presence of the 4-methoxyphenyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The α,4-dimethyl substitution indicates that there are two methyl groups attached to the alpha and fourth carbon of the thiazole, which may affect the compound's steric and electronic properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions, mechanisms of action, and potential applications would require further investigation through experimental studies. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity.

Formula: C₁₃H₁₆N₂OS·ClH

InChI: InChI=1S/C13H16N2OS.ClH/c1-8(14)12-9(2)15-13(17-12)10-4-6-11(16-3)7-5-10;/h4-8H,14H2,1-3H3;1H

InChI key: InChIKey=MOPXQYJRYQCNGZ-UHFFFAOYSA-N

SMILES: C(C)(N)C=1SC(=NC1C)C2=CC=C(OC)C=C2.Cl

Synonyms:

• 5-Thiazolemethanamine, 2-(4-methoxyphenyl)-α,4-dimethyl-, hydrochloride (1:1)

1-[2-(4-Methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]ethan-1-amine hydrochloride

CAS: 1306606-58-5

Versatile small molecule scaffold

Formula: C₁₃H₁₇ClN₂OS

Purity: Min. 95%

Molecular weight: 284.81 g/mol

Ref: 3D-GCC60658