CymitQuimica logo

CAS 1306606-98-3

:

β-(2-Methylbutyl)-2-pyridineethanamine

Description:
β-(2-Methylbutyl)-2-pyridineethanamine, identified by its CAS number 1306606-98-3, is an organic compound characterized by its pyridine and amine functional groups. This substance features a pyridine ring, which contributes to its aromatic properties, and an ethylamine chain that enhances its basicity and potential for hydrogen bonding. The presence of the 2-methylbutyl group adds to its hydrophobic characteristics, influencing its solubility and interaction with other molecules. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The structural configuration suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, β-(2-Methylbutyl)-2-pyridineethanamine represents a class of compounds that may possess unique properties suitable for various chemical and biological applications.
Formula:C12H20N2
InChI:InChI=1S/C12H20N2/c1-3-10(2)8-11(9-13)12-6-4-5-7-14-12/h4-7,10-11H,3,8-9,13H2,1-2H3
InChI key:InChIKey=GVOWGSAGLIAVPV-UHFFFAOYSA-N
SMILES:C(CC(CC)C)(CN)C1=CC=CC=N1
Synonyms:
  • 2-Pyridineethanamine, β-(2-methylbutyl)-
  • β-(2-Methylbutyl)-2-pyridineethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.