CAS 1306607-03-3

2-[Methyl[1-(phenylmethyl)-4-piperidinyl]amino]ethanol

Description:

2-[Methyl[1-(phenylmethyl)-4-piperidinyl]amino]ethanol, identified by its CAS number 1306607-03-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an ethanol moiety. This substance typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of hydroxyl and amino groups. It is likely to be a solid or liquid at room temperature, depending on its specific formulation and purity. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its potential interactions with biological systems. Its molecular structure suggests it could act as a ligand for various receptors, influencing neurotransmitter activity. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, the characteristics of this compound make it of interest in both research and industrial contexts, particularly in the fields of drug discovery and development.

Formula: C₁₅H₂₄N₂O

InChI: InChI=1S/C15H24N2O/c1-16(11-12-18)15-7-9-17(10-8-15)13-14-5-3-2-4-6-14/h2-6,15,18H,7-13H2,1H3

InChI key: InChIKey=TUEBPPKDRLPUHL-UHFFFAOYSA-N

SMILES: C(N1CCC(N(CCO)C)CC1)C2=CC=CC=C2

Synonyms:

• Ethanol, 2-[methyl[1-(phenylmethyl)-4-piperidinyl]amino]-
• 2-[Methyl[1-(phenylmethyl)-4-piperidinyl]amino]ethanol

2-[(1-Benzylpiperidin-4-yl)(methyl)amino]ethan-1-ol

CAS: 1306607-03-3

Versatile small molecule scaffold

Formula: C₁₅H₂₄N₂O

Purity: Min. 95%

Molecular weight: 248.36 g/mol

Ref: 3D-GCC60703