CAS 1306607-06-6

2,3-Dihydro-N,N-dimethyl-1H-isoindole-5-sulfonamide

Description:

2,3-Dihydro-N,N-dimethyl-1H-isoindole-5-sulfonamide is a chemical compound characterized by its unique isoindole structure, which features a bicyclic system that contributes to its stability and reactivity. This compound contains a sulfonamide functional group, which is known for its biological activity and potential pharmaceutical applications. The presence of dimethyl groups enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound's molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the dihydro configuration indicates that it may exist in a saturated form, which can affect its reactivity and interaction with other molecules. Overall, 2,3-Dihydro-N,N-dimethyl-1H-isoindole-5-sulfonamide is notable for its structural features that may confer specific properties relevant to drug development and other chemical applications.

Formula: C₁₀H₁₄N₂O₂S

InChI: InChI=1S/C10H14N2O2S/c1-12(2)15(13,14)10-4-3-8-6-11-7-9(8)5-10/h3-5,11H,6-7H2,1-2H3

InChI key: InChIKey=MQJABNPBKCFCGT-UHFFFAOYSA-N

SMILES: S(N(C)C)(=O)(=O)C=1C=C2C(=CC1)CNC2

Synonyms:

• 2,3-Dihydro-N,N-dimethyl-1H-isoindole-5-sulfonamide
• 1H-Isoindole-5-sulfonamide, 2,3-dihydro-N,N-dimethyl-