
CAS 1306607-10-2
:4-Acetyl-2-methyl-1H-imidazole-5-carboxamide
Description:
4-Acetyl-2-methyl-1H-imidazole-5-carboxamide is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an acetyl group and a carboxamide functional group, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and biochemistry. The presence of the methyl group at the second position of the imidazole ring influences its solubility and polarity, while the carboxamide group can participate in hydrogen bonding, enhancing its interactions with biological molecules. The compound's molecular structure suggests it may exhibit biological activity, making it of interest for drug development and research. Additionally, its unique combination of functional groups may allow for diverse synthetic modifications, enabling the exploration of its derivatives for specific applications. As with many imidazole derivatives, it may also exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would require empirical investigation.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c1-3(11)5-6(7(8)12)10-4(2)9-5/h1-2H3,(H2,8,12)(H,9,10)
InChI key:InChIKey=LLRRIULRWVSUBE-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(C(N)=O)N=C(C)N1
Synonyms:- 1H-Imidazole-5-carboxamide, 4-acetyl-2-methyl-
- 4-Acetyl-2-methyl-1H-imidazole-5-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.