CAS 1306610-19-4

4-Chloro-1,5-dimethyl-1H-pyrazole-3-carboxaldehyde

Description:

4-Chloro-1,5-dimethyl-1H-pyrazole-3-carboxaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and aldehyde functionality at the 3-position contributes to its reactivity and potential applications in organic synthesis. The dimethyl groups at the 1 and 5 positions enhance its steric properties and influence its solubility in various solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions, although it can be sensitive to moisture and light. Its chemical properties allow it to participate in various reactions, making it useful in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the aldehyde group suggests potential for further functionalization, enabling the synthesis of more complex molecules. Overall, 4-Chloro-1,5-dimethyl-1H-pyrazole-3-carboxaldehyde is a versatile compound with significant implications in chemical research and industry.

Formula: C₆H₇ClN₂O

InChI: InChI=1S/C6H7ClN2O/c1-4-6(7)5(3-10)8-9(4)2/h3H,1-2H3

InChI key: InChIKey=UCNUIDMZVFFWBH-UHFFFAOYSA-N

SMILES: C(=O)C=1C(Cl)=C(C)N(C)N1

Synonyms:

• 1H-Pyrazole-3-carboxaldehyde, 4-chloro-1,5-dimethyl-
• 4-Chloro-1,5-dimethyl-1H-pyrazole-3-carboxaldehyde

4-Chloro-1,5-dimethyl-1H-pyrazole-3-carbaldehyde

CAS: 1306610-19-4

Versatile small molecule scaffold

Formula: C₆H₇ClN₂O

Purity: Min. 95%

Molecular weight: 158.58 g/mol

Ref: 3D-GCC61019