
CAS 1306728-64-2
:(αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-thiazolepropanoic acid
Description:
The chemical substance known as (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-thiazolepropanoic acid, with the CAS number 1306728-64-2, is a synthetic compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group, commonly used in peptide synthesis to protect amino groups. The thiazolepropanoic acid moiety indicates that it possesses both acidic and basic functional groups, contributing to its potential as a building block in pharmaceutical chemistry. The stereochemistry is specified as (αS), indicating the configuration at the chiral center, which can influence the compound's biological activity and interactions. Overall, this compound is of interest in medicinal chemistry and peptide synthesis due to its unique structural features and potential applications in drug development.
Formula:C21H18N2O4S
InChI:InChI=1S/C21H18N2O4S/c24-20(25)18(11-19-22-9-10-28-19)23-21(26)27-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-10,17-18H,11-12H2,(H,23,26)(H,24,25)/t18-/m0/s1
InChI key:InChIKey=HBHYBVLFMJXMIX-SFHVURJKSA-N
SMILES:C(OC(N[C@@H](CC1=NC=CS1)C(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-thiazolepropanoic acid
- 2-Thiazolepropanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (αS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.