CymitQuimica logo

CAS 1306738-23-7

:

2-[(2,4-Dimethylphenyl)amino]butanoic acid hydrazide

Description:
2-[(2,4-Dimethylphenyl)amino]butanoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from butanoic acid. This compound features a 2,4-dimethylphenyl group attached to an amino group, indicating that it has both hydrophobic and hydrophilic characteristics. The presence of the butanoic acid moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrazide functional group can participate in various chemical reactions, including hydrazone formation and condensation reactions, making it versatile in synthetic chemistry. Additionally, the compound may exhibit biological activity, which could be of interest in drug discovery and development. Its molecular structure contributes to its physical properties, such as solubility and stability, which are crucial for its application in various fields, including biochemistry and materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H19N3O
InChI:InChI=1S/C12H19N3O/c1-4-10(12(16)15-13)14-11-6-5-8(2)7-9(11)3/h5-7,10,14H,4,13H2,1-3H3,(H,15,16)
InChI key:InChIKey=MJGIBSGZCMUKGU-UHFFFAOYSA-N
SMILES:N(C(C(NN)=O)CC)C1=C(C)C=C(C)C=C1
Synonyms:
  • 2-[(2,4-Dimethylphenyl)amino]butanoic acid hydrazide
  • Butanoic acid, 2-[(2,4-dimethylphenyl)amino]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.