CymitQuimica logo

CAS 1306738-24-8

:

2-[(3-Chlorophenyl)amino]butanoic acid hydrazide

Description:
2-[(3-Chlorophenyl)amino]butanoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is indicative of its potential reactivity and biological activity. The presence of a 3-chlorophenyl group suggests that the compound may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The butanoic acid moiety contributes to the compound's acidity and solubility characteristics, which can affect its behavior in biological systems. This compound may be of interest in medicinal chemistry due to its structural features that could lead to various therapeutic applications. Additionally, the hydrazide group can participate in various chemical reactions, including condensation and acylation, making it a versatile building block in organic synthesis. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, 2-[(3-Chlorophenyl)amino]butanoic acid hydrazide represents a compound with potential utility in research and development within the fields of chemistry and pharmacology.
Formula:C10H14ClN3O
InChI:InChI=1S/C10H14ClN3O/c1-2-9(10(15)14-12)13-8-5-3-4-7(11)6-8/h3-6,9,13H,2,12H2,1H3,(H,14,15)
InChI key:InChIKey=QPVUBPDQIJAMEE-UHFFFAOYSA-N
SMILES:N(C(C(NN)=O)CC)C1=CC(Cl)=CC=C1
Synonyms:
  • 2-[(3-Chlorophenyl)amino]butanoic acid hydrazide
  • Butanoic acid, 2-[(3-chlorophenyl)amino]-, hydrazide
  • 2-(3-chloroanilino)butanehydrazide
  • 2-[(3-Chlorophenyl)amino]butanohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.