CAS 1306738-33-9

1,3-Dimethyl-1H-pyrazole-4-acetonitrile

Description:

1,3-Dimethyl-1H-pyrazole-4-acetonitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two methyl groups attached to the first carbon of the pyrazole ring and an acetonitrile group at the fourth position. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the acetonitrile moiety contributes to its polar nature, making it soluble in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its unique structure allows for potential applications in various fields, including agrochemicals and materials science. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, depending on the reaction conditions. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₉N₃

InChI: InChI=1S/C7H9N3/c1-6-7(3-4-8)5-10(2)9-6/h5H,3H2,1-2H3

InChI key: InChIKey=NWHFTWDQSDQNBB-UHFFFAOYSA-N

SMILES: C(C#N)C=1C(C)=NN(C)C1

Synonyms:

• 1,3-Dimethyl-1H-pyrazole-4-acetonitrile
• 1H-Pyrazole-4-acetonitrile, 1,3-dimethyl-