CAS 1306738-36-2
:2-[[4-Ethyl-5-(3-methylphenyl)-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
Description:
2-[[4-Ethyl-5-(3-methylphenyl)-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is a chemical compound characterized by its complex structure, which includes a triazole ring, a thioether linkage, and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and triazoles, such as potential biological activity, including antimicrobial or antifungal properties. The presence of the ethyl and methyl groups in its structure may influence its solubility and reactivity, making it of interest in pharmaceutical and agricultural applications. The compound's molecular interactions can be significant in drug design, particularly in targeting specific biological pathways. Additionally, its hydrophilic and lipophilic balance may affect its bioavailability and pharmacokinetics. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C13H17N5OS
InChI:InChI=1S/C13H17N5OS/c1-3-18-12(10-6-4-5-9(2)7-10)16-17-13(18)20-8-11(19)15-14/h4-7H,3,8,14H2,1-2H3,(H,15,19)
InChI key:InChIKey=BOZXWOXLYCBATQ-UHFFFAOYSA-N
SMILES:C(C)N1C(=NN=C1SCC(NN)=O)C2=CC(C)=CC=C2
Synonyms:- 2-[[4-Ethyl-5-(3-methylphenyl)-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
- Acetic acid, 2-[[4-ethyl-5-(3-methylphenyl)-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.