CymitQuimica logo

CAS 1306738-58-8

:

2-[[5-[1-[(4-Bromophenyl)amino]ethyl]-4-methyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide

Description:
The chemical substance known as 2-[[5-[1-[(4-Bromophenyl)amino]ethyl]-4-methyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is a complex organic compound characterized by its unique structural features, including a triazole ring, a hydrazide functional group, and a bromophenyl moiety. This compound exhibits properties typical of hydrazides, such as potential reactivity with various electrophiles and the ability to form hydrogen bonds due to the presence of amine and carboxylic acid functionalities. The triazole ring contributes to its stability and may enhance its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the bromine atom can influence the compound's lipophilicity and overall reactivity. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its potential applications could range from medicinal chemistry to agricultural chemistry, depending on its biological activity and interaction with target molecules. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C13H17BrN6OS
InChI:InChI=1S/C13H17BrN6OS/c1-8(16-10-5-3-9(14)4-6-10)12-18-19-13(20(12)2)22-7-11(21)17-15/h3-6,8,16H,7,15H2,1-2H3,(H,17,21)
InChI key:InChIKey=CHNVIXIEOCXJDS-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Br)C=C1)(C)C=2N(C)C(SCC(NN)=O)=NN2
Synonyms:
  • 2-[[5-[1-[(4-Bromophenyl)amino]ethyl]-4-methyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
  • Acetic acid, 2-[[5-[1-[(4-bromophenyl)amino]ethyl]-4-methyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.