
CAS 1306738-61-3
:3-[3-(3-Fluorophenyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridine
Description:
The chemical substance known as 3-[3-(3-Fluorophenyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridine, with the CAS number 1306738-61-3, is a complex organic compound characterized by its unique structural features. It contains a pyrazolo[4,3-c]pyridine core, which is a bicyclic structure known for its potential biological activity. The presence of a 1,2,4-oxadiazole ring contributes to its chemical reactivity and may enhance its pharmacological properties. Additionally, the incorporation of a 3-fluorophenyl group suggests potential interactions with biological targets, as fluorine can influence lipophilicity and metabolic stability. This compound may exhibit interesting properties such as antimicrobial, anti-inflammatory, or anticancer activities, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve various organic reactions, and its behavior in biological systems would require further investigation through in vitro and in vivo studies to elucidate its therapeutic potential.
Formula:C15H14FN5O
InChI:InChI=1S/C15H14FN5O/c1-21-12-5-6-17-8-11(12)13(19-21)15-18-14(20-22-15)9-3-2-4-10(16)7-9/h2-4,7,17H,5-6,8H2,1H3
InChI key:InChIKey=ASHQTMDKHSFECF-UHFFFAOYSA-N
SMILES:CN1N=C(C2=C1CCNC2)C3=NC(=NO3)C4=CC(F)=CC=C4
Synonyms:- 1H-Pyrazolo[4,3-c]pyridine, 3-[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-methyl-
- 3-[3-(3-Fluorophenyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.