CAS 1306738-74-8
:2-[[[2-[(Phenylamino)sulfonyl]ethyl](3-pyridinylmethyl)amino]carbonyl]benzoic acid
Description:
The chemical substance known as 2-[[[2-[(Phenylamino)sulfonyl]ethyl](3-pyridinylmethyl)amino]carbonyl]benzoic acid, with the CAS number 1306738-74-8, is a complex organic compound characterized by its multi-functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming salts. The presence of a sulfonamide group, derived from phenylamino, indicates its potential for biological activity, possibly as an inhibitor or modulator in various biochemical pathways. The incorporation of a pyridine ring suggests that the compound may exhibit heterocyclic properties, which can influence its solubility and reactivity. Additionally, the ethyl linkage connects the sulfonamide and pyridine functionalities, enhancing the compound's structural diversity. Overall, this compound may possess significant pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular environment and conditions under which it is studied.
Formula:C22H21N3O5S
InChI:InChI=1S/C22H21N3O5S/c26-21(19-10-4-5-11-20(19)22(27)28)25(16-17-7-6-12-23-15-17)13-14-31(29,30)24-18-8-2-1-3-9-18/h1-12,15,24H,13-14,16H2,(H,27,28)
InChI key:InChIKey=UQLQZJMVMDHRHS-UHFFFAOYSA-N
SMILES:C(N(CC=1C=CC=NC1)CCS(NC2=CC=CC=C2)(=O)=O)(=O)C3=C(C(O)=O)C=CC=C3
Synonyms:- Benzoic acid, 2-[[[2-[(phenylamino)sulfonyl]ethyl](3-pyridinylmethyl)amino]carbonyl]-
- 2-[[[2-[(Phenylamino)sulfonyl]ethyl](3-pyridinylmethyl)amino]carbonyl]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.