CymitQuimica logo

CAS 1306738-76-0

:

Ethyl 7-(4-chlorophenyl)-1,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate

Description:
Ethyl 7-(4-chlorophenyl)-1,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyrimidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the 4-chlorophenyl group may influence its biological activity and interaction with various biological targets. The ethyl ester functional group suggests that it may undergo hydrolysis to yield the corresponding carboxylic acid, which could further impact its pharmacokinetic properties. Additionally, the compound's structure may confer specific reactivity patterns, making it suitable for various synthetic applications. Overall, this compound represents a class of triazolopyrimidine derivatives that are often explored for their potential therapeutic effects, particularly in the fields of medicinal chemistry and drug development.
Formula:C14H13ClN4O2
InChI:InChI=1S/C14H13ClN4O2/c1-2-21-13(20)11-7-16-14-17-8-18-19(14)12(11)9-3-5-10(15)6-4-9/h3-8,12H,2H2,1H3,(H,16,17,18)
InChI key:InChIKey=VRWXGGRVMOALAF-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(N2C(=NC1)NC=N2)C3=CC=C(Cl)C=C3
Synonyms:
  • [1,2,4]Triazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-(4-chlorophenyl)-1,7-dihydro-, ethyl ester
  • Ethyl 7-(4-chlorophenyl)-1,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.