CymitQuimica logo

CAS 1306738-78-2

:

2-[[4-(2,4-Dichlorophenyl)-5-[(1-naphthalenylamino)methyl]-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide

Description:
The chemical substance known as 2-[[4-(2,4-Dichlorophenyl)-5-[(1-naphthalenylamino)methyl]-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is characterized by its complex molecular structure, which includes a triazole ring, a thioether linkage, and a hydrazide functional group. This compound is notable for its potential biological activity, particularly in the field of pharmaceuticals, where it may exhibit antifungal or antimicrobial properties due to the presence of the triazole moiety. The dichlorophenyl group contributes to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. Additionally, the naphthalenylamino group may influence its interaction with biological targets, possibly affecting its efficacy and selectivity. The hydrazide functional group can participate in various chemical reactions, making this compound versatile for further chemical modifications. Overall, its unique structural features suggest that it could be of interest in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation.
Formula:C21H18Cl2N6OS
InChI:InChI=1S/C21H18Cl2N6OS/c22-14-8-9-18(16(23)10-14)29-19(27-28-21(29)31-12-20(30)26-24)11-25-17-7-3-5-13-4-1-2-6-15(13)17/h1-10,25H,11-12,24H2,(H,26,30)
InChI key:InChIKey=KARTUAZCJGAPMB-UHFFFAOYSA-N
SMILES:C(NC=1C2=C(C=CC1)C=CC=C2)C=3N(C(SCC(NN)=O)=NN3)C4=C(Cl)C=C(Cl)C=C4
Synonyms:
  • Acetic acid, 2-[[4-(2,4-dichlorophenyl)-5-[(1-naphthalenylamino)methyl]-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
  • 2-[[4-(2,4-Dichlorophenyl)-5-[(1-naphthalenylamino)methyl]-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
  • 2-({4-(2,4-Dichlorophenyl)-5-[(1-naphthylamino)-methyl]-4H-1,2,4-triazol-3-yl}thio)acetohydraz
  • 2-({4-(2,4-Dichlorophenyl)-5-[(1-naphthylamino)-methyl]-4H-1,2,4-triazol-3-yl}thio)acetohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.