CAS 1306738-81-7
:2-[[5-[[(4-Methylphenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]propanoic acid hydrazide
Description:
2-[[5-[[(4-Methylphenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]propanoic acid hydrazide is a complex organic compound characterized by its unique structural features, including a triazole ring and a hydrazide functional group. The presence of the 4-methylphenyl moiety suggests potential aromatic interactions, which may influence its solubility and reactivity. This compound likely exhibits properties typical of hydrazides, such as potential biological activity, making it of interest in pharmaceutical research. The thioether linkage in the structure may also contribute to its chemical reactivity and stability. Additionally, the presence of the propanoic acid component indicates that it may participate in acid-base reactions. Overall, this compound's intricate structure suggests a range of potential applications, particularly in medicinal chemistry, where it could serve as a lead compound for the development of new therapeutic agents. Further studies would be necessary to elucidate its specific properties, including solubility, stability, and biological activity.
Formula:C19H22N6OS
InChI:InChI=1S/C19H22N6OS/c1-13-8-10-15(11-9-13)21-12-17-23-24-19(27-14(2)18(26)22-20)25(17)16-6-4-3-5-7-16/h3-11,14,21H,12,20H2,1-2H3,(H,22,26)
InChI key:InChIKey=LUZIOMUXFKMISY-UHFFFAOYSA-N
SMILES:S(C(C(NN)=O)C)C=1N(C(CNC2=CC=C(C)C=C2)=NN1)C3=CC=CC=C3
Synonyms:- 2-[[5-[[(4-Methylphenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]propanoic acid hydrazide
- Propanoic acid, 2-[[5-[[(4-methylphenyl)amino]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.