CAS 1306738-83-9

N-(1-Methylethyl)-4-(4-piperidinylmethoxy)benzamide

Description:

N-(1-Methylethyl)-4-(4-piperidinylmethoxy)benzamide, identified by its CAS number 1306738-83-9, is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with a piperidine moiety and an isopropyl group. This compound typically exhibits properties associated with both amides and aromatic compounds, such as moderate solubility in organic solvents and potential bioactivity due to its piperidine ring, which is often associated with pharmacological effects. The presence of the methoxy group enhances its lipophilicity, potentially influencing its interaction with biological membranes. Additionally, the compound may exhibit specific binding affinities to various receptors, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like chromatography. As with many compounds of this nature, safety and handling precautions are essential due to potential toxicity or reactivity, underscoring the importance of thorough risk assessments in laboratory settings.

Formula: C₁₆H₂₄N₂O₂

InChI: InChI=1S/C16H24N2O2/c1-12(2)18-16(19)14-3-5-15(6-4-14)20-11-13-7-9-17-10-8-13/h3-6,12-13,17H,7-11H2,1-2H3,(H,18,19)

InChI key: InChIKey=LQGMYERBAVZAHO-UHFFFAOYSA-N

SMILES: C(NC(C)C)(=O)C1=CC=C(OCC2CCNCC2)C=C1

Synonyms:

• N-(1-Methylethyl)-4-(4-piperidinylmethoxy)benzamide
• Benzamide, N-(1-methylethyl)-4-(4-piperidinylmethoxy)-