CymitQuimica logo

CAS 1306738-91-9

:

2-[[5-[[(4-Iodophenyl)amino]methyl]-4-(2-propen-1-yl)-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide

Description:
2-[[5-[[(4-Iodophenyl)amino]methyl]-4-(2-propen-1-yl)-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is a complex organic compound characterized by its unique structural features, including a triazole ring, an iodine-substituted phenyl group, and a hydrazide functional group. The presence of the triazole moiety suggests potential biological activity, as triazoles are often found in pharmaceuticals and agrochemicals. The iodine atom may enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the hydrazide group can participate in various chemical reactions, including hydrazone formation and potential coordination with metal ions. This compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular structure. Its potential applications could span medicinal chemistry, where it may serve as a lead compound for drug development, or in materials science, depending on its physical properties. Further studies would be necessary to elucidate its precise characteristics and potential uses in various fields.
Formula:C14H17IN6OS
InChI:InChI=1S/C14H17IN6OS/c1-2-7-21-12(8-17-11-5-3-10(15)4-6-11)19-20-14(21)23-9-13(22)18-16/h2-6,17H,1,7-9,16H2,(H,18,22)
InChI key:InChIKey=OWBSENATMOVZME-UHFFFAOYSA-N
SMILES:C(C=C)N1C(CNC2=CC=C(I)C=C2)=NN=C1SCC(NN)=O
Synonyms:
  • 2-[[5-[[(4-Iodophenyl)amino]methyl]-4-(2-propen-1-yl)-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
  • Acetic acid, 2-[[5-[[(4-iodophenyl)amino]methyl]-4-(2-propen-1-yl)-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
  • 2-[(4-Allyl-5-{[(4-iodophenyl)amino]methyl}-4H-1,2,4-triazol-3-yl)thio]acetohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.