CymitQuimica logo

CAS 1306738-92-0

:

4,5,6,7-Tetrahydro-1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrazolo[4,3-c]pyridine

Description:
4,5,6,7-Tetrahydro-1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrazolo[4,3-c]pyridine is a heterocyclic compound characterized by its complex structure, which includes a fused pyrazolo and pyridine ring system. This compound features a tetrahydro configuration, indicating the presence of a saturated ring, and a methyl group that contributes to its overall stability and reactivity. The oxadiazole moiety introduces additional polar characteristics, which can enhance solubility in various solvents. The phenyl group attached to the oxadiazole adds to the compound's aromaticity, potentially influencing its electronic properties and interactions with biological targets. This compound may exhibit interesting pharmacological activities due to its unique structural features, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its properties can be further explored through spectroscopic methods. Overall, this compound represents a class of heterocycles that may have applications in drug development or material science.
Formula:C15H15N5O
InChI:InChI=1S/C15H15N5O/c1-20-12-7-8-16-9-11(12)13(18-20)15-17-14(19-21-15)10-5-3-2-4-6-10/h2-6,16H,7-9H2,1H3
InChI key:InChIKey=JSFPYLFUXQZLMM-UHFFFAOYSA-N
SMILES:CN1N=C(C2=C1CCNC2)C3=NC(=NO3)C4=CC=CC=C4
Synonyms:
  • 4,5,6,7-Tetrahydro-1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrazolo[4,3-c]pyridine
  • 1H-Pyrazolo[4,3-c]pyridine, 4,5,6,7-tetrahydro-1-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.