CAS 1306739-03-6
:2-Piperidinecarboxylic acid, 2-propyl-, methyl ester
Description:
2-Piperidinecarboxylic acid, 2-propyl-, methyl ester, also known by its CAS number 1306739-03-6, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxylic acid functional group that is esterified with a methyl group, contributing to its classification as an ester. The presence of a propyl group at the second position of the piperidine ring influences its physical and chemical properties, such as solubility and reactivity. Typically, esters like this compound exhibit moderate polarity, which can affect their solubility in various solvents. The compound may also participate in typical ester reactions, including hydrolysis and transesterification. Its potential applications could span across pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific uses would depend on further research and development. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C10H19NO2
InChI:InChI=1S/C10H19NO2/c1-3-6-10(9(12)13-2)7-4-5-8-11-10/h11H,3-8H2,1-2H3
InChI key:InChIKey=YNXUGRMPIGQMCM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CCC)CCCCN1
Synonyms:- 2-Piperidinecarboxylic acid, 2-propyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.