CAS 1306739-07-0

1-(Ethoxymethyl)-4-nitro-1H-pyrazole

Description:

1-(Ethoxymethyl)-4-nitro-1H-pyrazole is a chemical compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two adjacent nitrogen atoms. The presence of a nitro group at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The ethoxymethyl group at the 1-position enhances its solubility and may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The nitro group can participate in reduction reactions, while the ethoxymethyl moiety may undergo hydrolysis or other transformations. As with many nitrogen-containing compounds, it is essential to handle it with care due to potential toxicity or environmental impact. Overall, 1-(Ethoxymethyl)-4-nitro-1H-pyrazole is of interest in both synthetic and applied chemistry contexts.

Formula: C₆H₉N₃O₃

InChI: InChI=1S/C6H9N3O3/c1-2-12-5-8-4-6(3-7-8)9(10)11/h3-4H,2,5H2,1H3

InChI key: InChIKey=SDEIRDJUCBOBTO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CN(COCC)N=C1

Synonyms:

• 1H-Pyrazole, 1-(ethoxymethyl)-4-nitro-
• 1-(Ethoxymethyl)-4-nitro-1H-pyrazole