CAS 1306739-10-5

5-[(2,4-Dimethylphenoxy)methyl]-N-methyl-1,2,4-oxadiazole-3-ethanamine

Description:

5-[(2,4-Dimethylphenoxy)methyl]-N-methyl-1,2,4-oxadiazole-3-ethanamine, identified by its CAS number 1306739-10-5, is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the 2,4-dimethylphenoxy group suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. The N-methyl group enhances its lipophilicity, potentially affecting its pharmacokinetics. This compound may be of interest in medicinal chemistry due to its structural features, which could be linked to various biological activities, including antimicrobial or anti-inflammatory effects. Its synthesis typically involves multi-step organic reactions, and its stability can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data should be consulted to assess toxicity and handling precautions. Overall, this compound represents a class of substances that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₄H₁₉N₃O₂

InChI: InChI=1S/C14H19N3O2/c1-10-4-5-12(11(2)8-10)18-9-14-16-13(17-19-14)6-7-15-3/h4-5,8,15H,6-7,9H2,1-3H3

InChI key: InChIKey=AUABNSIBGADZST-UHFFFAOYSA-N

SMILES: C(OC1=C(C)C=C(C)C=C1)C2=NC(CCNC)=NO2

Synonyms:

• 5-[(2,4-Dimethylphenoxy)methyl]-N-methyl-1,2,4-oxadiazole-3-ethanamine
• 1,2,4-Oxadiazole-3-ethanamine, 5-[(2,4-dimethylphenoxy)methyl]-N-methyl-