
CAS 1306739-21-8
:5-[(2-Chloro-5-methylphenoxy)methyl]-N-methyl-1,2,4-oxadiazole-3-ethanamine
Description:
5-[(2-Chloro-5-methylphenoxy)methyl]-N-methyl-1,2,4-oxadiazole-3-ethanamine is a chemical compound characterized by its complex structure, which includes an oxadiazole ring, an amine group, and a chlorinated aromatic moiety. The presence of the oxadiazole ring suggests potential applications in pharmaceuticals, particularly in the development of bioactive compounds due to its heterocyclic nature. The chlorinated phenoxy group may enhance lipophilicity and influence the compound's interaction with biological targets. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the functional groups present. Additionally, the N-methyl substitution may affect its pharmacokinetic properties, such as solubility and permeability. Overall, the unique combination of functional groups in this molecule positions it as a candidate for further investigation in medicinal chemistry and related fields. However, specific properties such as solubility, melting point, and biological activity would require empirical data for comprehensive characterization.
Formula:C13H16ClN3O2
InChI:InChI=1S/C13H16ClN3O2/c1-9-3-4-10(14)11(7-9)18-8-13-16-12(17-19-13)5-6-15-2/h3-4,7,15H,5-6,8H2,1-2H3
InChI key:InChIKey=FTYDUQUCMPOQFN-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C=CC(C)=C1)C2=NC(CCNC)=NO2
Synonyms:- 5-[(2-Chloro-5-methylphenoxy)methyl]-N-methyl-1,2,4-oxadiazole-3-ethanamine
- 1,2,4-Oxadiazole-3-ethanamine, 5-[(2-chloro-5-methylphenoxy)methyl]-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.