CAS 1306739-28-5
:5-Methyl-7-(phenylmethyl)pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7H)-one
Description:
5-Methyl-7-(phenylmethyl)pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7H)-one is a complex organic compound characterized by its unique bicyclic structure that incorporates both pyridine and triazole moieties. This compound features a methyl group at the 5-position and a phenylmethyl group at the 7-position, contributing to its potential biological activity. The presence of the pyrimidinone functional group suggests that it may exhibit properties typical of heterocyclic compounds, such as the ability to participate in hydrogen bonding and act as a potential ligand in various chemical reactions. Its structural complexity may also influence its solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 1306739-28-5, allows for precise identification and retrieval of information in chemical databases. Overall, this substance may have applications in pharmacology, particularly in the development of new therapeutic agents targeting specific biological pathways.
Formula:C16H13N5O
InChI:InChI=1S/C16H13N5O/c1-11-14-13(21-16(19-11)17-10-18-21)7-8-20(15(14)22)9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3
InChI key:InChIKey=WTCIYJOGQJHASS-UHFFFAOYSA-N
SMILES:O=C1C2=C(N3C(N=C2C)=NC=N3)C=CN1CC4=CC=CC=C4
Synonyms:- 5-Methyl-7-(phenylmethyl)pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7H)-one
- Pyrido[3,4-e][1,2,4]triazolo[1,5-a]pyrimidin-6(7H)-one, 5-methyl-7-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.