CAS 1306739-29-6
:1-(10,10a-Dihydro-4-hydroxypyrimido[1,2-a]benzimidazol-3-yl)ethanone
Description:
1-(10,10a-Dihydro-4-hydroxypyrimido[1,2-a]benzimidazol-3-yl)ethanone, identified by its CAS number 1306739-29-6, is a chemical compound that features a complex bicyclic structure. This substance is characterized by the presence of a pyrimidine and benzimidazole moiety, which contributes to its potential biological activity. The hydroxyl group at the 4-position of the pyrimidine ring suggests that it may exhibit hydrogen-bonding capabilities, influencing its solubility and reactivity. The ethanone functional group indicates that it may participate in acylation reactions or serve as a precursor for further chemical modifications. The compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be assessed through various analytical methods. Overall, this compound represents a fascinating area of study for researchers exploring novel therapeutic agents.
Formula:C12H11N3O2
InChI:InChI=1S/C12H11N3O2/c1-7(16)8-6-13-12-14-9-4-2-3-5-10(9)15(12)11(8)17/h2-6,12,14,17H,1H3
InChI key:InChIKey=XTVOAPXXHFQWOH-UHFFFAOYSA-N
SMILES:OC=1N2C=3C(NC2N=CC1C(C)=O)=CC=CC3
Synonyms:- Ethanone, 1-(10,10a-dihydro-4-hydroxypyrimido[1,2-a]benzimidazol-3-yl)-
- 1-(10,10a-Dihydro-4-hydroxypyrimido[1,2-a]benzimidazol-3-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.