CymitQuimica logo

CAS 1306739-31-0

:

1-(5-Amino-3-cyclopropyl-1H-pyrazol-1-yl)-2-propanone

Description:
1-(5-Amino-3-cyclopropyl-1H-pyrazol-1-yl)-2-propanone is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with an amino group and a cyclopropyl group. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the amino group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in drug development. The cyclopropyl moiety can influence the compound's steric and electronic properties, potentially affecting its biological activity. Additionally, the compound's molecular weight, solubility, and stability are influenced by its functional groups and overall structure. As with many pyrazole derivatives, it may exhibit a range of pharmacological activities, including anti-inflammatory or analgesic effects, although specific biological data would be necessary to confirm these properties. Overall, this compound represents a class of heterocyclic compounds that are valuable in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c1-6(13)5-12-9(10)4-8(11-12)7-2-3-7/h4,7H,2-3,5,10H2,1H3
InChI key:InChIKey=QJMXYCIOSULMRA-UHFFFAOYSA-N
SMILES:C(C(C)=O)N1N=C(C=C1N)C2CC2
Synonyms:
  • 2-Propanone, 1-(5-amino-3-cyclopropyl-1H-pyrazol-1-yl)-
  • 1-(5-Amino-3-cyclopropyl-1H-pyrazol-1-yl)-2-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.