CAS 1306739-32-1
:4-Nitro-1-tricyclo[3.3.1.13,7]dec-2-yl-1H-pyrazole-3-carboxylic acid
Description:
4-Nitro-1-tricyclo[3.3.1.1^3,7]dec-2-yl-1H-pyrazole-3-carboxylic acid is a complex organic compound characterized by its unique bicyclic structure and the presence of a nitro group and a carboxylic acid functional group. The tricyclic framework contributes to its rigidity and potential for specific interactions in biological systems. The nitro group typically enhances the compound's reactivity and can influence its electronic properties, while the carboxylic acid group may participate in hydrogen bonding and contribute to solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy for structural confirmation. Additionally, the compound's stability, solubility, and reactivity would be influenced by the steric and electronic effects of the tricyclic system and the functional groups present. Overall, 4-Nitro-1-tricyclo[3.3.1.1^3,7]dec-2-yl-1H-pyrazole-3-carboxylic acid represents a fascinating example of complex organic chemistry with potential applications in various fields.
Formula:C14H17N3O4
InChI:InChI=1S/C14H17N3O4/c18-14(19)12-11(17(20)21)6-16(15-12)13-9-2-7-1-8(4-9)5-10(13)3-7/h6-10,13H,1-5H2,(H,18,19)
InChI key:InChIKey=XFKAVEXMZMQGBI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CN(C2C3CC4CC2CC(C3)C4)N=C1C(O)=O
Synonyms:- 1H-Pyrazole-3-carboxylic acid, 4-nitro-1-tricyclo[3.3.1.13,7]dec-2-yl-
- 4-Nitro-1-tricyclo[3.3.1.13,7]dec-2-yl-1H-pyrazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.