CAS 1306739-36-5
:2-[[5-[1-[(4-Ethoxyphenyl)amino]ethyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
Description:
The chemical substance known as 2-[[5-[1-[(4-Ethoxyphenyl)amino]ethyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide is characterized by its complex molecular structure, which includes a triazole ring, an ethoxyphenyl group, and a hydrazide functional group. This compound is likely to exhibit properties typical of hydrazides, such as potential reactivity with various electrophiles and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. The triazole ring contributes to its stability and may impart biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the ethoxyphenyl group may enhance lipophilicity, influencing its solubility and permeability in biological systems. The compound's specific interactions and applications would depend on its precise molecular configuration and the functional groups involved, which could lead to various biological activities, including antimicrobial or anticancer properties. Further studies would be necessary to elucidate its full potential and mechanisms of action.
Formula:C20H24N6O2S
InChI:InChI=1S/C20H24N6O2S/c1-3-28-17-11-9-15(10-12-17)22-14(2)19-24-25-20(29-13-18(27)23-21)26(19)16-7-5-4-6-8-16/h4-12,14,22H,3,13,21H2,1-2H3,(H,23,27)
InChI key:InChIKey=LOBLPJGPVPCJPX-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(OCC)C=C1)(C)C=2N(C(SCC(NN)=O)=NN2)C3=CC=CC=C3
Synonyms:- 2-[[5-[1-[(4-Ethoxyphenyl)amino]ethyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]acetic acid hydrazide
- Acetic acid, 2-[[5-[1-[(4-ethoxyphenyl)amino]ethyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.