CAS 1306739-42-3

Methyl 3-propyl-3-piperidinecarboxylate

Description:

Methyl 3-propyl-3-piperidinecarboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a propyl group and a methyl ester functional group, contributing to its overall reactivity and solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of the ester and the nitrogen atom in the piperidine ring, which can engage in hydrogen bonding. The presence of the propyl group may enhance hydrophobic interactions, influencing its solubility in organic solvents. Methyl 3-propyl-3-piperidinecarboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its synthesis often involves standard organic reactions such as esterification and alkylation. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings.

Formula: C₁₀H₁₉NO₂

InChI: InChI=1S/C10H19NO2/c1-3-5-10(9(12)13-2)6-4-7-11-8-10/h11H,3-8H2,1-2H3

InChI key: InChIKey=HUUTZPCUFMIMEB-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(CCC)CCCNC1

Synonyms:

• 3-Piperidinecarboxylic acid, 3-propyl-, methyl ester
• Methyl 3-propyl-3-piperidinecarboxylate