CymitQuimica logo

CAS 1306739-44-5

:

Ethyl 5-(2-methoxyacetyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate

Description:
Ethyl 5-(2-methoxyacetyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the methoxyacetyl group enhances its potential for various chemical reactions, including acylation and esterification. The two methyl groups at the 2 and 4 positions of the pyrrole ring provide additional steric hindrance, which can influence its reactivity and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure with potential applications in organic synthesis and pharmaceuticals.
Formula:C12H17NO4
InChI:InChI=1S/C12H17NO4/c1-5-17-12(15)10-7(2)11(13-8(10)3)9(14)6-16-4/h13H,5-6H2,1-4H3
InChI key:InChIKey=RDNWHULVLOSOCD-UHFFFAOYSA-N
SMILES:C(COC)(=O)C1=C(C)C(C(OCC)=O)=C(C)N1
Synonyms:
  • 1H-Pyrrole-3-carboxylic acid, 5-(2-methoxyacetyl)-2,4-dimethyl-, ethyl ester
  • Ethyl 5-(2-methoxyacetyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.